| Identification | |
| Name: | 2-Methylbenzylamine |
| Synonyms: | o-Xylylamine; Methylbenzylamine,97%; 2-Xylylamine |
| CAS: | 89-93-0 |
| EINECS: | 201-952-1 |
| Molecular Formula: | C8H11N |
| Molecular Weight: | 121.18 |
| InChI: | InChI=1/C8H11N/c1-7-4-2-3-5-8(7)6-9/h2-5H,6,9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2735 |
| Melting Point: | <0 |
| Density: | 0.977 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5415-1.5435 |
| Solubility: | Very soluble |
| Appearance: | Colorless to light yellow liquid |
| Specification: |
2-Methylbenzylamine (CAS NO.89-93-0), its Synonyms are alpha-Amino-2-xylene ; o-Methylbenzylamine ; o-Xylylamine ; Benzenemethanamine, 2-methyl- ; Benzylamine, o-methyl- . It is Colorless to light yellow liquid. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry place. Store in a tightly closed container. |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
