| Identification | |
| Name: | 3-Methylbenzylamine |
| Synonyms: | Benzylamine,m-methyl- (8CI);((3-Methylphenyl)methyl)amine;Benzenemethanamine,3-methyl-;m-Methylbenzylamine;m-Xylylamine;1-(3-Methylphenyl)methanamine;Benzylamine, m-methyl-; |
| CAS: | 100-81-2 |
| EINECS: | 202-890-8 |
| Molecular Formula: | C8H11N |
| Molecular Weight: | 121.18 |
| InChI: | InChI=1/C8H11N/c1-7-3-2-4-8(5-7)6-9/h2-5H,6,9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2735 |
| Density: | 0.966 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.535-1.537 |
| Solubility: | Very soluble |
| Appearance: | Clear liquid |
| Specification: | Colorless to light yellow liqui Safety Statements:26-27-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 27:Take off immediately all contaminated clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | III |
| Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry place. Store in a tightly closed container. |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
