| Identification | |
| Name: | Methacryloyl chloride |
| Synonyms: | 2-Methylpropenoyl chloride |
| CAS: | 920-46-7 |
| EINECS: | 213-058-9 |
| Molecular Formula: | C4H5ClO |
| Molecular Weight: | 104.53 |
| InChI: | InChI=1/C4H5ClO/c1-3(2)4(5)6/h1H2,2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3383 |
| Density: | 1.076 |
| Stability: | Stable at room temperature in closed containers under normal storage. |
| Refractive index: | 1.442 |
| Water Solubility: | Reacts |
| Solubility: | Reacts |
| Appearance: | colorless to yellow liquid |
| Packinggroup: | I |
| Sensitive: | Moisture Sensitive |
| Usage: | A hydrogel with 80% water absorption was obtained from reaction of 2-hydroxyethyl methacrylate, containing small amounts of ethylene glycol dimethacrylate with the reaction product of poly(vinylpyrrolidinone) & methacryloyl chloride contact lenses. |
| Safety Data | |
| Hazard Symbols |
F:Flammable
T+:Verytoxic
|
 |
|
