| Identification | |
| Name: | iopanoic acid |
| Synonyms: | 2-(3-amino-2,4,6-triiodobenzyl)butyric acid; Iodopanoicacid; 98%; Iodopanoic acid |
| CAS: | 96-83-3 |
| EINECS: | 202-539-9 |
| Molecular Formula: | C11H12I3NO2 |
| Molecular Weight: | 570.93 |
| InChI: | InChI=1/C11H12I3NO2/c1-2-5(11(16)17)3-6-7(12)4-8(13)10(15)9(6)14/h4-5H,2-3,15H2,1H3,(H,16,17) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 153 °C |
| Flash Point: | 273.8°C |
| Boiling Point: | 529.1°Cat760mmHg |
| Density: | 2.426g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.732 |
| Solubility: | Insoluble |
| Specification: |
Iopanoic acid (96-83-3),which also can be called for 3-Amino-alpha-ethyl-2,4,6-triiodo-benzenepropanoicaci ; 3-Amino-alpha-ethyl-2,4,6-triiodobenzenepropanoicacid ; 3-Amino-alpha-ethyl-2,4,6-triiodo-hydrocinnamicaci ; 3-Amino-ethyl-2,4,6-triiodobenaenepropanoicacid ; 3-Amino-ethyl-2,4,6-triiodohydrocinnamicacid ; Beta-(3-amino-2,4,6-triiodophenyl)-alpha-ethylpropionicacid ; Bilijodon ; Choladine .When Iopanoic acid (96-83-3) was heated,it emits toxic fumes of I− and NOx .This chemical is insoluble in water. |
| Flash Point: | 273.8°C |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Usage: | Medication. |
| Safety Data | |
 |
|
