| Identification | |
| Name: | m-Xylylenediamine |
| Synonyms: | 1,3-Bis(aminomethyl)benzene; m-Xylene-alpha,alpha-diamine; MXDA; Xylylenediamine,98%; alpha,alpha-diamino-m-xylene; m-xylen-alpha,alpha-ylenediamine; meta-Xylenediamine; 1,3-Benzenedimethanamine |
| CAS: | 1477-55-0 |
| EINECS: | 216-032-5 |
| Molecular Formula: | C8H12N2 |
| Molecular Weight: | 136.2 |
| InChI: | InChI=1/C8H12N2/c9-5-7-2-1-3-8(4-7)6-10/h1-4H,5-6,9-10H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2735 8/PG 2 |
| Density: | 1.032 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.57-1.572 |
| Water Solubility: | Miscible |
| Solubility: | Miscible |
| Appearance: | Colorless to yellow liquid. |
| Packinggroup: | II |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. |
| Color: | COLORLESS LIQ Colorless liquid. |
| Usage: | Curing agent for epoxy resins, a source of m-xylylene diisocyanate. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
