| Identification | |
| Name: | 4-Fluoroaniline |
| Synonyms: | Fluoroanilinepaleredliq; p-Fluoroaniline ; Benzenamine, 4-fluoro- |
| CAS: | 371-40-4 |
| EINECS: | 206-735-5 |
| Molecular Formula: | C6H6FN |
| Molecular Weight: | 111.12 |
| InChI: | InChI=1/C6H6FN/c7-5-1-3-6(8)4-2-5/h1-4H,8H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2944 |
| Density: | 1.1586 |
| Stability: | Stable. Incompatible with acids, oxidizing agents. |
| Refractive index: | 1.5385-1.5405 |
| Solubility: | soluble |
| Appearance: | pale yellow to brown liquid |
| Specification: |
?4-Fluoroaniline ,?its cas register number is 371-40-4. It also can be called?1-Amino-4-fluorobenzene ; 4-12-00-01104 (Beilstein Handbook Reference) ; 4-Fluorobenzenamine ; Aniline, 4-fluoro- ; Aniline, p-fluoro- ; Benzenamine, 4-fluoro- ; |
| Report: |
Reported in EPA TSCA Inventory. EPA Genetic Toxicology Program. |
| Packinggroup: | III |
| HS Code: | 29214210 |
| Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry place. Store in a tightly closed container. Keep from contact with oxidizing materials. |
| Color: | LIQUID PALE YELLOW |
| Usage: | Intermediate in manufacture of herbicides & plant growth regulators. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
