| Identification | |
| Name: | 1,3-Difluorobenzene |
| Synonyms: | m-Difluorobenzene; m-Difluro Benzene; 1?-Difluorobenzene; Aspartic acid beta-monoamide |
| CAS: | 372-18-9 |
| EINECS: | 206-746-5 |
| Molecular Formula: | C6H4F2 |
| Molecular Weight: | 114.09 |
| InChI: | InChI=1/C6H4F2/c7-5-2-1-3-6(8)4-5/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 |
| Density: | 1.163 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.437-1.439 |
| Water Solubility: | insoluble |
| Solubility: | insoluble in water |
| Appearance: | clear colorless to yellowish liquid |
| Specification: |
?1,3-Difluorobenzene (CAS NO.372-18-9) is also named as NSC 10285 ; m-Difluorobenzene ; Benzene, 1,3-difluoro- (9CI) ; Benzene, m-difluoro- .?1,3-Difluorobenzene (CAS NO.372-18-9) is clear colorless to yellowish liquid. It is toxic and flammable. It will produce toxic?fluoride gas by heat. So the storage environment should be ventilate, low-temperature and dry. Keep?1,3-Difluorobenzene (CAS NO.372-18-9) separate from oxidant. |
| Packinggroup: | II |
| HS Code: | 29036990 |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
F:Flammable
|
 |
|
