| Identification | |
| Name: | DL-Tropic acid |
| Synonyms: | alpha-(Hydroxymethyl)benzeneacetic acid; DL-3-Hydroxy-2-phenylpropionic acid; Tropic acid |
| CAS: | 529-64-6 |
| EINECS: | 208-465-3 |
| Molecular Formula: | C9H10O3 |
| Molecular Weight: | 166.18 |
| InChI: | InChI=1/C9H10O3/c10-6-8(9(11)12)7-4-2-1-3-5-7/h1-5,8,10H,6H2,(H,11,12)/p-1/t8-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Boiling Point: | 328 |
| Stability: | Stable under normal temperatures and pressures. |
| Solubility: | Very soluble |
| Appearance: | White powder. |
| Specification: | white to off-white crystalline powder Safety Statements:22-24/25-36/37/39-36-26 22:Do not breathe dust 24/25:Avoid contact with skin and eyes 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| HS Code: | 29181980 |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Plant growth regulator. |
| Safety Data | |
 |
|
