| Identification | |
| Name: | DL-Mercaptosuccinic acid |
| Synonyms: | Thiomalic acid; Mercaptosuccinic acid |
| CAS: | 70-49-5 |
| EINECS: | 200-736-4 |
| Molecular Formula: | C4H6O4S |
| Molecular Weight: | 150.15 |
| InChI: | InChI=1/C4H6O4S/c5-3(6)1-2(9)4(7)8/h2,9H,1H2,(H,5,6)(H,7,8) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.528 g/cm3 |
| Refractive index: | 1.555 |
| Solubility: | SOLVENT |
| Appearance: | white crystalline powder |
| Specification: | white to almost white crystalline powder Safety Statements:26-36-36/37/39-45-27 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 27:Take off immediately all contaminated clothing |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29309070 |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
