| Identification | |
| Name: | DL-Bromosuccinic acid |
| Synonyms: | Bromobutanedioic acid; Bromosuccinic Acid |
| CAS: | 923-06-8 |
| EINECS: | 213-087-7 |
| Molecular Formula: | C4H5BrO4 |
| Molecular Weight: | 196.9841 |
| InChI: | InChI=1S/C4H5BrO4/c5-2(4(8)9)1-3(6)7/h2H,1H2,(H,6,7)(H,8,9) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1759 |
| Density: | 2.073 |
| Water Solubility: | insoluble in ether |
| Solubility: | insoluble in ether |
| Appearance: | white Powder |
| Specification: | white to off-white crystalline powder Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Packinggroup: | III |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
