| Identification |
| Name: | Phosphoric acid, 2-ethylhexyl ester, compd. with 2,2,2-nitrilotris(ethanol) |
| Synonyms: | Phosphoric acid, 2-ethylhexyl ester, compd. with 2,2',2''-nitrilotris(ethanol);2-Ethylhexanol phosphate, triethanolamine salt;2-Ethylhexyl phosphate triethanolamine salt;Phosphoric acid, 2-ethylhexyl ester, triethanolamine salt;2-(bis(2-hydroxyethyl)amino)ethanol; 2-ethylhexan-1-ol; phosphoric acid |
| CAS: | 68189-01-5 |
| EINECS: | 269-172-4 |
| Molecular Formula: | C14H36NO8P |
| Molecular Weight: | 377.4113 |
| InChI: | InChI=1/C8H18O.C6H15NO3.H3O4P/c1-3-5-6-8(4-2)7-9;8-4-1-7(2-5-9)3-6-10;1-5(2,3)4/h8-9H,3-7H2,1-2H3;8-10H,1-6H2;(H3,1,2,3,4) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 185°C |
| Boiling Point: | 335.4°C at 760 mmHg |
| Flash Point: | 185°C |
| Safety Data |
| |
 |