| Identification | |
| Name: | Boric acid, compd. with 2,2',2''-nitrilotris[ethanol] |
| Synonyms: | Boric acid, compd. with 2,2',2''-nitrilotris[ethanol];Einecs 270-252-6 |
| CAS: | 68413-80-9 |
| EINECS: | 270-252-6 |
| Molecular Formula: | C6H18BNO6 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C6H15NO3.BH3O3/c8-4-1-7(2-5-9)3-6-10;2-1(3)4/h8-10H,1-6H2;2-4H |
| Molecular Structure: | ![(C6H18BNO6) Boric acid, compd. with 2,2',2''-nitrilotris[ethanol];Einecs 270-252-6](https://img1.guidechem.com/structure/image/68413-80-9.gif) |
| Properties | |
| Flash Point: | 185°C |
| Boiling Point: | 335.4°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 185°C |
| Safety Data | |
 |
|
