| Identification |
| Name: | Boric acid, compd. with 2,2'-iminobis[ethanol] and 2,2',2''-nitrilotris[ethanol] |
| Synonyms: | Boric acid, compd. with 2,2'-iminobis(ethanol) and 2,2',2''-nitrilotris(ethanol);Boric acid, diethanolamine, triethanolamine salt;2-(bis(2-hydroxyethyl)amino)ethanol; boric acid; 2-(2-hydroxyethylamino)ethanol |
| CAS: | 68345-30-2 |
| EINECS: | 269-852-0 |
| Molecular Formula: | C10H29BN2O8 |
| Molecular Weight: | 316.1569 |
| InChI: | InChI=1/C6H15NO3.C4H11NO2.BH3O3/c8-4-1-7(2-5-9)3-6-10;6-3-1-5-2-4-7;2-1(3)4/h8-10H,1-6H2;5-7H,1-4H2;2-4H |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 185°C |
| Boiling Point: | 335.4°C at 760 mmHg |
| Flash Point: | 185°C |
| Safety Data |
| |
 |
