| Identification |
| Name: | Phosphoric acid, ethyl ester, compd. with 2,2',2''-nitrilotris[ethanol] |
| Synonyms: | Phosphoric acid, ethyl ester, compd. with 2,2',2''-nitrilotris(ethanol);2-(bis(2-hydroxyethyl)amino)ethanol; ethyl dihydrogen phosphate |
| CAS: | 98143-53-4 |
| EINECS: | 308-619-0 |
| Molecular Formula: | C8H22NO7P |
| Molecular Weight: | 275.2365 |
| InChI: | InChI=1/C6H15NO3.C2H7O4P/c8-4-1-7(2-5-9)3-6-10;1-2-6-7(3,4)5/h8-10H,1-6H2;2H2,1H3,(H2,3,4,5) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 268.4°C |
| Boiling Point: | 520.2°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 268.4°C |
| Safety Data |
| |
 |
