| Identification |
| Name: | Phosphoric acid, methyl ester, compd. with 2,2',2''-nitrilotris[ethanol] |
| Synonyms: | Phosphoric acid, methyl ester, compd. with 2,2',2''-nitrilotris(ethanol);2-(bis(2-hydroxyethyl)amino)ethanol; methyl dihydrogen phosphate |
| CAS: | 93919-62-1 |
| EINECS: | 300-046-4 |
| Molecular Formula: | C7H20NO7P |
| Molecular Weight: | 261.21 |
| InChI: | InChI=1/C6H15NO3.CH5O4P/c8-4-1-7(2-5-9)3-6-10;1-5-6(2,3)4/h8-10H,1-6H2;1H3,(H2,2,3,4) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 265.7°C |
| Boiling Point: | 515.7°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 265.7°C |
| Safety Data |
| |
 |
