| Identification | |
| Name: | Dimethyl acetylenedicarboxylate |
| Synonyms: | DMAD; dimethyl butynedioate; Acetylenedicarboxylic acid dimethyl ester~Butynedioic acid dimethyl ester~DMAD; DIMETHYL ACETYLENEDICARBOXYLATE (DMADC) |
| CAS: | 762-42-5 |
| EINECS: | 212-098-4 |
| Molecular Formula: | C6H6O4 |
| Molecular Weight: | 142.11 |
| InChI: | InChI=1/C6H6O4/c1-9-5(7)3-4-6(8)10-2/h1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 |
| Density: | 1.16 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.446-1.448 |
| Solubility: | Slightly soluble |
| Appearance: | clear colorless to light yellow liquid |
| Specification: |
?Dimethyl acetylenedicarboxylate (CAS NO.762-42-5), its Synonyms are Acetylenedicarboxylic acid dimethyl ester ;? 2-Butynedioic acid, 1,4-dimethyl ester ; 2-Butynedioic acid, dimethyl ester ; 1,2-Bis(methoxycarbonyl)acetylene ; Bis(methoxycarbonyl)acetylene . It is clear colorless to light yellow liquid. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29171990 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Store in a cool, dry place. Store in a tightly closed container. Corrosives area. |
| Sensitive: | Light Sensitive |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
