| Identification | |
| Name: | Dimethyl fluoromalonate |
| Synonyms: | Malonicacid, fluoro-, dimethyl ester (8CI);Propanedioic acid, fluoro-, dimethyl ester(9CI);2-Fluoromalonic acid dimethyl ester;Dimethyl a-fluoromalonate; |
| CAS: | 344-14-9 |
| EINECS: | -0 |
| Molecular Formula: | C5H7FO4 |
| Molecular Weight: | 150.1 |
| InChI: | InChI=1/C5H7FO4/c1-9-4(7)3(6)5(8)10-2/h3H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | Cool, dry |
| Density: | 1.211 g/cm3 |
| Refractive index: | 1.4032 |
| Appearance: | white to light yellow crystal powder |
| Specification: |
3-Thiophenecarboxylicacid, 5-formyl-, methyl ester , with CAS number of 67808-66-6, can be called propanedioic acid, 2-fluoro-, dimethyl ester ; Dimethyl fluoromalonate . It is a white to light yellow crystal powder. |
| Packinggroup: | II |
| Safety Data | |
| Hazard Symbols |
T: Toxic
C: Corrosive
|
 |
|
