| Identification | |
| Name: | Nitrobenzene |
| Synonyms: | Benzene,nitro-; Essence of Mirbane; essenceofmirbane; NCI-C60082; Nitrobenzeen; Nitrobenzen; nitro-benzen; Oil of Myrbane- |
| CAS: | 98-95-3 |
| EINECS: | 202-716-0 |
| Molecular Formula: | C6H5NO2 |
| Molecular Weight: | 123.11 |
| InChI: | InChI=1/C6H5NO2/c8-7(9)6-4-2-1-3-5-6/h1-5H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1662 |
| Density: | 1.205 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong reducing agents, strong bases. Flammable. Note wide explosion limits. |
| Refractive index: | 1.5503-1.5523 |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble in Water |
| Appearance: | yellow liquid |
| Packinggroup: | II |
| Color: | Greenish-yellow crystals or yellow, oily liquid Colorless to yellow, oily liquid (Note: A solid below 42 degrees F). Bright-yellow crystals or pale-yellow to colorless, oily liquid |
| Safety Data | |
| Hazard Symbols |
T:Toxic
N:Dangerousfortheenvironment
|
 |
|
