| Identification |
| Name: | Sebacoyl chloride |
| Synonyms: | Sebacoylchloride (6CI,8CI);Decanedioic acid dichloride;Decanedioic dichloride;Decanedioyl chloride;NSC 56763;Sebacic acid chloride;Sebacic aciddichloride;Sebacic dichloride;Sebacoyl dichloride;Sebacyl chloride;Decanedioyl dichloride; |
| CAS: | 111-19-3 |
| EINECS: | 203-843-4 |
| Molecular Formula: | C10H16Cl2O2 |
| Molecular Weight: | 239.1382 |
| InChI: | InChI=1S/C10H16Cl2O2/c11-9(13)7-5-3-1-2-4-6-8-10(12)14/h1-8H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN3129 |
| Melting Point: | -2.5 deg C |
| Density: | 1.135 g/cm3 |
| Stability: | Reacts violently with water liberating toxic gas. Incompatible with water, oxidizing agents, amines, alcohols. |
| Refractive index: | n20/D 1.468(lit.) |
| Water Solubility: | MAY DECOMPOSE with water |
| Solubility: | MAY DECOMPOSE with water |
| Appearance: | light yellow Clear liquid |
| Packinggroup: | II |
| Storage Temperature: | 2-8°C |
| Sensitive: | Moisture Sensitive |
| Color: | yellow |
| Safety Data |
| Hazard Symbols |
C: Corrosive
|
| |
 |
