| Identification | |
| Name: | DL-Anabasine |
| Synonyms: | 2-Pyridin-3-ylpiperidine; (+/-)-Anabasine; Neonicotine~2-(3-Pyridyl)piperidine |
| CAS: | 13078-04-1 |
| EINECS: | 207-791-3 |
| Molecular Formula: | C10H13NO |
| Molecular Weight: | 163.21 |
| InChI: | InChI=1/C10H14N2/c1-2-7-12-10(5-1)9-4-3-6-11-8-9/h3-4,6,8,10,12H,1-2,5,7H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3140 6.1/PG 2 |
| Density: | 1.046 |
| Refractive index: | 1.5440 |
| Solubility: | Soluble in most organic solvents Soluble in alcohol and ether Miscible in water @ 25 deg C [Shiu WY et al; Rev Environ Contam Toxicol 116: 15-187 (1990)] PubMed Abstract |
| Appearance: | colourless oil |
| Packinggroup: | I |
| Color: | colorless to yellow |
| Usage: | A nicotinic receptor agonist |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
