| Identification | |
| Name: | DL-Isoleucine |
| Synonyms: | (DL)-2-Amino-3-methylpentanoic acid; dl-isoleucine mixt. of 50% dl-isoleucine +50% dl-alloisoleuc; (+/-)-2-Amino-3-methylpentanoic acid~H-DL-Ile-OH |
| CAS: | 443-79-8 |
| EINECS: | 207-139-8 |
| Molecular Formula: | C6H13NO2 |
| Molecular Weight: | 131.17 |
| InChI: | InChI=1/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.035 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.462 |
| Solubility: | 22.3 g/L (25 oC) in water |
| Appearance: | white powder |
| Specification: | white powder Safety Statements:22-24/25-36 22:Do not breathe dust 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing |
| HS Code: | 29224995 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | Waxy, shiny, rhombic leaflets from alcohol Crystals |
| Safety Data | |
 |
|
