| Identification | |
| Name: | DIPHENYLENEIODONIUM CHLORIDE |
| Synonyms: | DIBENZIODOLIUM CHLORIDE;DPI;DPI CHLORIDE;DIPHENYLENEIODONIUM CHLORIDE;[1,1'-BIPHENYL]-2,2'-DIYLIODONIUM CHLORIDE;Diphenyleneiodonium chloride, 97+%;Dibenziodolium chloride, DPI;Diphenyleneiodonium chlorideDibenziodolium chloride |
| CAS: | 4673-26-1 |
| Molecular Formula: | C12H8ClI |
| Molecular Weight: | 314.55 |
| InChI: | InChI=1/C12H8I.ClH/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;/h1-8H;1H |
| Molecular Structure: | ![(C12H8ClI) DIBENZIODOLIUM CHLORIDE;DPI;DPI CHLORIDE;DIPHENYLENEIODONIUM CHLORIDE;[1,1'-BIPHENYL]-2,2'-DIYLIODON...](https://img.guidechem.com/structure/4673-26-1.gif) |
| Properties | |
| Melting Point: | 312-322 °C |
| Specification: | Crystalline Solid usageEng:Binds strongly to flavoproteins and thus inhibits NO synthase, NADG reductase and NADPH oxidase. Solubility: 5 mg in 1.7 mL of H2O:DMSO 40:60; 10 mg in 1.1 mL H2O:DMSO 10:90 Safety Statements:26 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Storage Temperature: | -20°C |
| Usage: | Binds strongly to flavoproteins and thus inhibits NO synthase, NADG reductase and NADPH oxidase. Solubility: 5 mg in 1.7 mL of H2O:DMSO 40:60; 10 mg in 1.1 mL H2O:DMSO 10:9 |
| Safety Data | |
 |
|
