| Identification |
| Name: | Hydrocinnamoyl chloride |
| Synonyms: | 3-Phenylpropionyl chloride; 2-Diacetylamino-3,5-Dibromobenzyl Bromide; 2-Ethoxybenzyl Chloride; 3-Chloropropiophenone; benzenepropanoyl chloride; N-Acetyl-phe-lys |
| CAS: | 645-45-4 |
| EINECS: | 211-443-6 |
| Molecular Formula: | C9H9ClO |
| Molecular Weight: | 168.62 |
| InChI: | InChI=1/C9H9ClO/c10-9(11)7-6-8-4-2-1-3-5-8/h1-5H,6-7H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3265 8 |
| Density: | 1.137 |
| Stability: | Stable under normal shipping and handling conditions. However, may decompose if exposed to moist air or water. |
| Refractive index: | 1.526-1.528 |
| Solubility: | Insoluble |
| Appearance: | deep greenish-yellow |
| Packinggroup: | II |
| HS Code: | 29163900 |
| Storage Temperature: | Corrosives area. Keep containers tightly closed. Store protected from moisture. Store in a cool, dry area away from incompatible substances. |
| Sensitive: | Moisture Sensitive |
| Color: | deep greenish-yellow |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
