| Identification | |
| Name: | DL-Arginine |
| Synonyms: | Arginine,DL- (8CI); |
| CAS: | 7200-25-1 |
| EINECS: | 230-571-3 |
| Molecular Formula: | C6H14N4O2 |
| Molecular Weight: | 174.2 |
| InChI: | InChI=1/C6H14N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t4-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.46 g/cm3 |
| Solubility: | Soluble in water:155 g/L (20 oC) |
| Appearance: | White powder |
| Specification: | white powder Safety Statements:26-39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 39:Wear eye/face protection |
| HS Code: | 29252000 |
| Sensitive: | Air Sensitive |
| Color: | Prisms containing 2 mol H2O from water; anhydrous monoclinic plates from 66% alcohol |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
