| Identification | |
| Name: | 3-nitrobenzoic acid sodium salt |
| Synonyms: | Sodium 3-nitrobenzoate; Sodium m-nitrobenzoate |
| CAS: | 827-95-2 |
| EINECS: | 212-578-3 |
| Molecular Formula: | C7H4NNaO4 |
| Molecular Weight: | 189.1 |
| InChI: | InChI=1/C7H5NO4.Na/c9-7(10)5-2-1-3-6(4-5)8(11)12;/h1-4H,(H,9,10);/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Melting Point: | >300ºC |
| Density: | 1.13g/cm3 |
| Refractive index: | 1.492 |
| Solubility: | 1 g dissolves in 320 mL water, 3 mL alc, 4 mL ether, 18 mL chloroform, about 2 mL methanol, 2.5 mL acetone Very slightly sol in benzene, carbon disulfide, petroleum ether Soluble in oxygenated and chlorinated solvents In water, 3,576 mg/L at 25 deg C |
| Appearance: | yellowish crystalline powder |
| Packinggroup: | III |
| Color: | off-white to yellow |
| Safety Data | |
| Hazard Symbols | |
 |
|
